C24H28F2N2O2 — CID 56546226
2-(diethylamino)-1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-2-phenylethanone (PubChem CID 56546226) has the molecular formula C24H28F2N2O2 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-(diethylamino)-1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-2-phenylethanone.
| Compound Name | 2-(diethylamino)-1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 56546226 |
| Molecular Formula | C24H28F2N2O2 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2-(diethylamino)-1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-2-phenylethanone |
| SMILES | CCN(CC)C(C(=O)N1CCC(C(=O)c2cc(F)ccc2F)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H28F2N2O2/c1-3-27(4-2)22(17-8-6-5-7-9-17)24(30)28-14-12-18(13-15-28)23(29)20-16-19(25)10-11-21(20)26/h5-11,16,18,22H,3-4,12-15H2,1-2H3 |
| InChIKey | MDNADQOSCSRFAB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |