C22H30N2O2 — CID 56546435
2-(diethylamino)-N-[(4-ethoxyphenyl)methyl]-N-methyl-2-phenylacetamide (PubChem CID 56546435) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-(diethylamino)-N-[(4-ethoxyphenyl)methyl]-N-methyl-2-phenylacetamide.
| Compound Name | 2-(diethylamino)-N-[(4-ethoxyphenyl)methyl]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 56546435 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 2-(diethylamino)-N-[(4-ethoxyphenyl)methyl]-N-methyl-2-phenylacetamide |
| SMILES | CCOc1ccc(CN(C)C(=O)C(c2ccccc2)N(CC)CC)cc1 |
| InChI | InChI=1S/C22H30N2O2/c1-5-24(6-2)21(19-11-9-8-10-12-19)22(25)23(4)17-18-13-15-20(16-14-18)26-7-3/h8-16,21H,5-7,17H2,1-4H3 |
| InChIKey | PCTDAODJQVTGIB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |