C24H22N4OS — CID 56547770
(E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[[2-[4-(pyrazol-1-ylmethyl)phenyl]phenyl]methyl]prop-2-enamide (PubChem CID 56547770) has the molecular formula C24H22N4OS and a molecular weight of 414.53 g/mol. Its IUPAC name is (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[[2-[4-(pyrazol-1-ylmethyl)phenyl]phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[[2-[4-(pyrazol-1-ylmethyl)phenyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 56547770 |
| Molecular Formula | C24H22N4OS |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[[2-[4-(pyrazol-1-ylmethyl)phenyl]phenyl]methyl]prop-2-enamide |
| SMILES | Cc1nc(/C=C/C(=O)NCc2ccccc2-c2ccc(Cn3cccn3)cc2)cs1 |
| InChI | InChI=1S/C24H22N4OS/c1-18-27-22(17-30-18)11-12-24(29)25-15-21-5-2-3-6-23(21)20-9-7-19(8-10-20)16-28-14-4-13-26-28/h2-14,17H,15-16H2,1H3,(H,25,29)/b12-11+ |
| InChIKey | AQAKFFIINHXQHE-VAWYXSNFSA-N |
| XLogP | 4.69 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|