C25H31N3O3 — CID 56548469
4-[4-[[1-(cyclopentylmethyl)piperidin-4-yl]carbamoyl]phenoxy]benzamide (PubChem CID 56548469) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-[4-[[1-(cyclopentylmethyl)piperidin-4-yl]carbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[[1-(cyclopentylmethyl)piperidin-4-yl]carbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56548469 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 4-[4-[[1-(cyclopentylmethyl)piperidin-4-yl]carbamoyl]phenoxy]benzamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(C(=O)NC3CCN(CC4CCCC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C25H31N3O3/c26-24(29)19-5-9-22(10-6-19)31-23-11-7-20(8-12-23)25(30)27-21-13-15-28(16-14-21)17-18-3-1-2-4-18/h5-12,18,21H,1-4,13-17H2,(H2,26,29)(H,27,30) |
| InChIKey | AOGRAUQKDQHERK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |