C17H24N2O3S — CID 167788597
N-[1-[(1,1-dioxothiolan-2-yl)methyl]piperidin-4-yl]benzamide (PubChem CID 167788597) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[1-[(1,1-dioxothiolan-2-yl)methyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[(1,1-dioxothiolan-2-yl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 167788597 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-[1-[(1,1-dioxothiolan-2-yl)methyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(CC2CCCS2(=O)=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C17H24N2O3S/c20-17(14-5-2-1-3-6-14)18-15-8-10-19(11-9-15)13-16-7-4-12-23(16,21)22/h1-3,5-6,15-16H,4,7-13H2,(H,18,20) |
| InChIKey | DSTKIEMIRWRBGQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |