C23H20N4O3 — CID 56548828
4-[4-[(7-methylimidazo[1,2-a]pyridin-2-yl)methylcarbamoyl]phenoxy]benzamide (PubChem CID 56548828) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-[4-[(7-methylimidazo[1,2-a]pyridin-2-yl)methylcarbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[(7-methylimidazo[1,2-a]pyridin-2-yl)methylcarbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56548828 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-[4-[(7-methylimidazo[1,2-a]pyridin-2-yl)methylcarbamoyl]phenoxy]benzamide |
| SMILES | Cc1ccn2cc(CNC(=O)c3ccc(Oc4ccc(C(N)=O)cc4)cc3)nc2c1 |
| InChI | InChI=1S/C23H20N4O3/c1-15-10-11-27-14-18(26-21(27)12-15)13-25-23(29)17-4-8-20(9-5-17)30-19-6-2-16(3-7-19)22(24)28/h2-12,14H,13H2,1H3,(H2,24,28)(H,25,29) |
| InChIKey | ZTVPISNFVONFIY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |