C26H30N2O3 — CID 56550721
2-[2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)amino]-1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]ethanone (PubChem CID 56550721) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-[2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)amino]-1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-[2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)amino]-1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 56550721 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 2-[2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)amino]-1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]ethanone |
| SMILES | C#CCN(CC(=O)N1CCCC1c1cc(OC)ccc1OC)C1CCc2ccccc21 |
| InChI | InChI=1S/C26H30N2O3/c1-4-15-27(23-13-11-19-8-5-6-9-21(19)23)18-26(29)28-16-7-10-24(28)22-17-20(30-2)12-14-25(22)31-3/h1,5-6,8-9,12,14,17,23-24H,7,10-11,13,15-16,18H2,2-3H3 |
| InChIKey | OENHHXPNQUUXFE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|