C23H36N6O — CID 56550729
N-butyl-6-methyl-1-[5-(5-phenyltetrazol-2-yl)pentyl]piperidine-3-carboxamide (PubChem CID 56550729) has the molecular formula C23H36N6O and a molecular weight of 412.58 g/mol. Its IUPAC name is N-butyl-6-methyl-1-[5-(5-phenyltetrazol-2-yl)pentyl]piperidine-3-carboxamide.
| Compound Name | N-butyl-6-methyl-1-[5-(5-phenyltetrazol-2-yl)pentyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56550729 |
| Molecular Formula | C23H36N6O |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | N-butyl-6-methyl-1-[5-(5-phenyltetrazol-2-yl)pentyl]piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CCC(C)N(CCCCCn2nnc(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C23H36N6O/c1-3-4-15-24-23(30)21-14-13-19(2)28(18-21)16-9-6-10-17-29-26-22(25-27-29)20-11-7-5-8-12-20/h5,7-8,11-12,19,21H,3-4,6,9-10,13-18H2,1-2H3,(H,24,30) |
| InChIKey | NZVFRKKYKAVNNW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|