C20H29Cl2N3O2 — CID 56525948
N-butyl-1-[3-(2,5-dichloroanilino)-3-oxopropyl]-6-methylpiperidine-3-carboxamide (PubChem CID 56525948) has the molecular formula C20H29Cl2N3O2 and a molecular weight of 414.38 g/mol. Its IUPAC name is N-butyl-1-[3-(2,5-dichloroanilino)-3-oxopropyl]-6-methylpiperidine-3-carboxamide.
| Compound Name | N-butyl-1-[3-(2,5-dichloroanilino)-3-oxopropyl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 56525948 |
| Molecular Formula | C20H29Cl2N3O2 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N-butyl-1-[3-(2,5-dichloroanilino)-3-oxopropyl]-6-methylpiperidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CCC(C)N(CCC(=O)Nc2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C20H29Cl2N3O2/c1-3-4-10-23-20(27)15-6-5-14(2)25(13-15)11-9-19(26)24-18-12-16(21)7-8-17(18)22/h7-8,12,14-15H,3-6,9-11,13H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | LHUWPZFSBXCRKB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|