C13H16Cl2N2O2 — CID 78962492
N-(2,5-dichlorophenyl)-3-[(3S)-3-hydroxypyrrolidin-1-yl]propanamide (PubChem CID 78962492) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-3-[(3S)-3-hydroxypyrrolidin-1-yl]propanamide.
| Compound Name | N-(2,5-dichlorophenyl)-3-[(3S)-3-hydroxypyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 78962492 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-(2,5-dichlorophenyl)-3-[(3S)-3-hydroxypyrrolidin-1-yl]propanamide |
| SMILES | O=C(CCN1CC[C@H](O)C1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O2/c14-9-1-2-11(15)12(7-9)16-13(19)4-6-17-5-3-10(18)8-17/h1-2,7,10,18H,3-6,8H2,(H,16,19)/t10-/m0/s1 |
| InChIKey | FTHGYPWRTSRROD-JTQLQIEISA-N |
| XLogP | 2.39 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |