C21H24Cl2N4O2 — CID 56525983
N-(2,5-dichlorophenyl)-3-[4-(phenylcarbamoylamino)piperidin-1-yl]propanamide (PubChem CID 56525983) has the molecular formula C21H24Cl2N4O2 and a molecular weight of 435.36 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-3-[4-(phenylcarbamoylamino)piperidin-1-yl]propanamide.
| Compound Name | N-(2,5-dichlorophenyl)-3-[4-(phenylcarbamoylamino)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 56525983 |
| Molecular Formula | C21H24Cl2N4O2 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-(2,5-dichlorophenyl)-3-[4-(phenylcarbamoylamino)piperidin-1-yl]propanamide |
| SMILES | O=C(CCN1CCC(NC(=O)Nc2ccccc2)CC1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H24Cl2N4O2/c22-15-6-7-18(23)19(14-15)26-20(28)10-13-27-11-8-17(9-12-27)25-21(29)24-16-4-2-1-3-5-16/h1-7,14,17H,8-13H2,(H,26,28)(H2,24,25,29) |
| InChIKey | KCXIDVAUGJUVTR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |