C25H34N2O3 — CID 56552060
N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-5-(3-methylphenoxy)pentanamide (PubChem CID 56552060) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-5-(3-methylphenoxy)pentanamide.
| Compound Name | N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-5-(3-methylphenoxy)pentanamide |
|---|---|
| PubChem CID | 56552060 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]-5-(3-methylphenoxy)pentanamide |
| SMILES | Cc1cccc(OCCCCC(=O)NCc2ccc(CN3CCC(O)CC3)cc2)c1 |
| InChI | InChI=1S/C25H34N2O3/c1-20-5-4-6-24(17-20)30-16-3-2-7-25(29)26-18-21-8-10-22(11-9-21)19-27-14-12-23(28)13-15-27/h4-6,8-11,17,23,28H,2-3,7,12-16,18-19H2,1H3,(H,26,29) |
| InChIKey | HYAHOGLNBGSVMV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|