C21H30N4O3S — CID 56555908
4-(diethylsulfamoyl)-1-methyl-N-[4-(3-methylpyrrolidin-1-yl)phenyl]pyrrole-2-carboxamide (PubChem CID 56555908) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-1-methyl-N-[4-(3-methylpyrrolidin-1-yl)phenyl]pyrrole-2-carboxamide.
| Compound Name | 4-(diethylsulfamoyl)-1-methyl-N-[4-(3-methylpyrrolidin-1-yl)phenyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 56555908 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 4-(diethylsulfamoyl)-1-methyl-N-[4-(3-methylpyrrolidin-1-yl)phenyl]pyrrole-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)Nc2ccc(N3CCC(C)C3)cc2)n(C)c1 |
| InChI | InChI=1S/C21H30N4O3S/c1-5-25(6-2)29(27,28)19-13-20(23(4)15-19)21(26)22-17-7-9-18(10-8-17)24-12-11-16(3)14-24/h7-10,13,15-16H,5-6,11-12,14H2,1-4H3,(H,22,26) |
| InChIKey | QXUHCVLBPQEXSM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|