C19H29N3O — CID 56560960
1-(3,4-dimethyl-N-pentan-3-ylanilino)-3-pyrazol-1-ylpropan-2-ol (PubChem CID 56560960) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-(3,4-dimethyl-N-pentan-3-ylanilino)-3-pyrazol-1-ylpropan-2-ol.
| Compound Name | 1-(3,4-dimethyl-N-pentan-3-ylanilino)-3-pyrazol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 56560960 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 1-(3,4-dimethyl-N-pentan-3-ylanilino)-3-pyrazol-1-ylpropan-2-ol |
| SMILES | CCC(CC)N(CC(O)Cn1cccn1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H29N3O/c1-5-17(6-2)22(18-9-8-15(3)16(4)12-18)14-19(23)13-21-11-7-10-20-21/h7-12,17,19,23H,5-6,13-14H2,1-4H3 |
| InChIKey | HAECOENUYBJRCF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|