C15H21N3O — CID 56780909
1-(3,4-dimethylphenyl)-2-(2-pyrazol-1-ylethylamino)ethanol (PubChem CID 56780909) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-(2-pyrazol-1-ylethylamino)ethanol.
| Compound Name | 1-(3,4-dimethylphenyl)-2-(2-pyrazol-1-ylethylamino)ethanol |
|---|---|
| PubChem CID | 56780909 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-(2-pyrazol-1-ylethylamino)ethanol |
| SMILES | Cc1ccc(C(O)CNCCn2cccn2)cc1C |
| InChI | InChI=1S/C15H21N3O/c1-12-4-5-14(10-13(12)2)15(19)11-16-7-9-18-8-3-6-17-18/h3-6,8,10,15-16,19H,7,9,11H2,1-2H3 |
| InChIKey | UQPPAXUROFQCRI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|