C10H17N3O — CID 63299027
1-cyclopropyl-2-(2-pyrazol-1-ylethylamino)ethanol (PubChem CID 63299027) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2-pyrazol-1-ylethylamino)ethanol.
| Compound Name | 1-cyclopropyl-2-(2-pyrazol-1-ylethylamino)ethanol |
|---|---|
| PubChem CID | 63299027 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 1-cyclopropyl-2-(2-pyrazol-1-ylethylamino)ethanol |
| SMILES | OC(CNCCn1cccn1)C1CC1 |
| InChI | InChI=1S/C10H17N3O/c14-10(9-2-3-9)8-11-5-7-13-6-1-4-12-13/h1,4,6,9-11,14H,2-3,5,7-8H2 |
| InChIKey | HYTOODOEBCXVMS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|