C18H24N4O — CID 95757886
N-[(R)-cyclopropyl-(4-methylphenyl)methyl]-2-(2-pyrazol-1-ylethylamino)acetamide (PubChem CID 95757886) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N-[(R)-cyclopropyl-(4-methylphenyl)methyl]-2-(2-pyrazol-1-ylethylamino)acetamide.
| Compound Name | N-[(R)-cyclopropyl-(4-methylphenyl)methyl]-2-(2-pyrazol-1-ylethylamino)acetamide |
|---|---|
| PubChem CID | 95757886 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-[(R)-cyclopropyl-(4-methylphenyl)methyl]-2-(2-pyrazol-1-ylethylamino)acetamide |
| SMILES | Cc1ccc([C@H](NC(=O)CNCCn2cccn2)C2CC2)cc1 |
| InChI | InChI=1S/C18H24N4O/c1-14-3-5-15(6-4-14)18(16-7-8-16)21-17(23)13-19-10-12-22-11-2-9-20-22/h2-6,9,11,16,18-19H,7-8,10,12-13H2,1H3,(H,21,23)/t18-/m0/s1 |
| InChIKey | ZBECTCCWDOWPKT-SFHVURJKSA-N |
| XLogP | 2.05 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|