C18H20N4OS — CID 95612062
N-[(S)-phenyl(thiophen-2-yl)methyl]-2-(2-pyrazol-1-ylethylamino)acetamide (PubChem CID 95612062) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is N-[(S)-phenyl(thiophen-2-yl)methyl]-2-(2-pyrazol-1-ylethylamino)acetamide.
| Compound Name | N-[(S)-phenyl(thiophen-2-yl)methyl]-2-(2-pyrazol-1-ylethylamino)acetamide |
|---|---|
| PubChem CID | 95612062 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[(S)-phenyl(thiophen-2-yl)methyl]-2-(2-pyrazol-1-ylethylamino)acetamide |
| SMILES | O=C(CNCCn1cccn1)N[C@@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C18H20N4OS/c23-17(14-19-10-12-22-11-5-9-20-22)21-18(16-8-4-13-24-16)15-6-2-1-3-7-15/h1-9,11,13,18-19H,10,12,14H2,(H,21,23)/t18-/m0/s1 |
| InChIKey | MRTVHCLKHFTWPM-SFHVURJKSA-N |
| XLogP | 2.44 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|