C23H28N4OS — CID 86895496
N-[phenyl(thiophen-2-yl)methyl]-3-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]propanamide (PubChem CID 86895496) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is N-[phenyl(thiophen-2-yl)methyl]-3-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]propanamide.
| Compound Name | N-[phenyl(thiophen-2-yl)methyl]-3-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 86895496 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-[phenyl(thiophen-2-yl)methyl]-3-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]propanamide |
| SMILES | O=C(CCN1CCC(Cn2cccn2)CC1)NC(c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C23H28N4OS/c28-22(25-23(21-8-4-17-29-21)20-6-2-1-3-7-20)11-16-26-14-9-19(10-15-26)18-27-13-5-12-24-27/h1-8,12-13,17,19,23H,9-11,14-16,18H2,(H,25,28) |
| InChIKey | CFSNHRPEVYHMAG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |