C19H24N4O2S — CID 122555886
4-(3-amino-3-oxopropyl)-N-[phenyl(thiophen-2-yl)methyl]piperazine-1-carboxamide (PubChem CID 122555886) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is 4-(3-amino-3-oxopropyl)-N-[phenyl(thiophen-2-yl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-(3-amino-3-oxopropyl)-N-[phenyl(thiophen-2-yl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 122555886 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-(3-amino-3-oxopropyl)-N-[phenyl(thiophen-2-yl)methyl]piperazine-1-carboxamide |
| SMILES | NC(=O)CCN1CCN(C(=O)NC(c2ccccc2)c2cccs2)CC1 |
| InChI | InChI=1S/C19H24N4O2S/c20-17(24)8-9-22-10-12-23(13-11-22)19(25)21-18(16-7-4-14-26-16)15-5-2-1-3-6-15/h1-7,14,18H,8-13H2,(H2,20,24)(H,21,25) |
| InChIKey | HKURHSGASNATAB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |