C14H16BrFN4O2S — CID 56561968
2-(4-bromo-2-fluorophenoxy)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]acetamide (PubChem CID 56561968) has the molecular formula C14H16BrFN4O2S and a molecular weight of 403.28 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenoxy)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]acetamide.
| Compound Name | 2-(4-bromo-2-fluorophenoxy)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 56561968 |
| Molecular Formula | C14H16BrFN4O2S |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 2-(4-bromo-2-fluorophenoxy)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]acetamide |
| SMILES | CCn1c(CCNC(=O)COc2ccc(Br)cc2F)n[nH]c1=S |
| InChI | InChI=1S/C14H16BrFN4O2S/c1-2-20-12(18-19-14(20)23)5-6-17-13(21)8-22-11-4-3-9(15)7-10(11)16/h3-4,7H,2,5-6,8H2,1H3,(H,17,21)(H,19,23) |
| InChIKey | CEMZNEIYUKWFDL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|