C20H29N5O4 — CID 56563623
tert-butyl N-[4-[[2-methyl-1-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propyl]amino]-4-oxobutyl]carbamate (PubChem CID 56563623) has the molecular formula C20H29N5O4 and a molecular weight of 403.48 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-methyl-1-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propyl]amino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-methyl-1-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propyl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 56563623 |
| Molecular Formula | C20H29N5O4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | tert-butyl N-[4-[[2-methyl-1-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propyl]amino]-4-oxobutyl]carbamate |
| SMILES | CC(C)C(NC(=O)CCCNC(=O)OC(C)(C)C)c1nc(-c2ccncc2)no1 |
| InChI | InChI=1S/C20H29N5O4/c1-13(2)16(18-24-17(25-29-18)14-8-11-21-12-9-14)23-15(26)7-6-10-22-19(27)28-20(3,4)5/h8-9,11-13,16H,6-7,10H2,1-5H3,(H,22,27)(H,23,26) |
| InChIKey | SVPDMTZXGPSULU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|