C22H28N4O4S — CID 56564227
4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-4-oxobutanamide (PubChem CID 56564227) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-4-oxobutanamide.
| Compound Name | 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 56564227 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-4-oxobutanamide |
| SMILES | O=C(CCC(=O)N1CCSc2ccccc21)NCCCN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C22H28N4O4S/c27-18(8-9-19(28)25-14-15-31-17-7-2-1-6-16(17)25)23-12-5-13-26-20(29)22(24-21(26)30)10-3-4-11-22/h1-2,6-7H,3-5,8-15H2,(H,23,27)(H,24,30) |
| InChIKey | CFUYMLIPBQUYNS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|