About 1-cyclohexyl-2,5-dimethyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyrrole-3-carboxamide
1-cyclohexyl-2,5-dimethyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyrrole-3-carboxamide (PubChem CID 56569542) has the molecular formula C23H37N3O
and a molecular weight of 371.57 g/mol. Its IUPAC name is 1-cyclohexyl-2,5-dimethyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyrrole-3-carboxamide.
Molecular Properties
| Compound Name | 1-cyclohexyl-2,5-dimethyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyrrole-3-carboxamide |
| PubChem CID | 56569542 |
| Molecular Formula | C23H37N3O |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.29 |
| IUPAC Name | 1-cyclohexyl-2,5-dimethyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyrrole-3-carboxamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)c2cc(C)n(C3CCCCC3)c2C)CC1 |
| InChI | InChI=1S/C23H37N3O/c1-17(2)10-13-25-14-11-20(12-15-25)24-23(27)22-16-18(3)26(19(22)4)21-8-6-5-7-9-21/h10,16,20-21H,5-9,11-15H2,1-4H3,(H,24,27) |
| InChIKey | GKDZSIWEXCPKBL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-2,5-dimethyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyrrole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2,5-dimethyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyrrole-3-carboxamide?
The IUPAC name of 1-cyclohexyl-2,5-dimethyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyrrole-3-carboxamide (CID 56569542) is 1-cyclohexyl-2,5-dimethyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyrrole-3-carboxamide.
What is the SMILES notation for 1-cyclohexyl-2,5-dimethyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyrrole-3-carboxamide?
The canonical SMILES for 1-cyclohexyl-2,5-dimethyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyrrole-3-carboxamide is CC(C)=CCN1CCC(NC(=O)c2cc(C)n(C3CCCCC3)c2C)CC1.
What is the InChIKey of 1-cyclohexyl-2,5-dimethyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyrrole-3-carboxamide?
The InChIKey is GKDZSIWEXCPKBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H37N3O/c1-17(2)10-13-25-14-11-20(12-15-25)24-23(27)22-16-18(3)26(19(22)4)21-8-6-5-7-9-21/h10,16,20-21H,5-9,11-15H2,1-4H3,(H,24,27).
What are the key properties of 1-cyclohexyl-2,5-dimethyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyrrole-3-carboxamide?
1-cyclohexyl-2,5-dimethyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyrrole-3-carboxamide has a molecular weight of 371.57 g/mol, XLogP of 4.77, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2,5-dimethyl-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]pyrrole-3-carboxamide is sourced from PubChem (CID 56569542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).