C22H31F2N3O2 — CID 56569608
2,6-difluoro-N-[3-methyl-1-[[1-(3-methylbut-2-enyl)piperidin-4-yl]amino]-1-oxobutan-2-yl]benzamide (PubChem CID 56569608) has the molecular formula C22H31F2N3O2 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2,6-difluoro-N-[3-methyl-1-[[1-(3-methylbut-2-enyl)piperidin-4-yl]amino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[3-methyl-1-[[1-(3-methylbut-2-enyl)piperidin-4-yl]amino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 56569608 |
| Molecular Formula | C22H31F2N3O2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 2,6-difluoro-N-[3-methyl-1-[[1-(3-methylbut-2-enyl)piperidin-4-yl]amino]-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)C(NC(=O)c2c(F)cccc2F)C(C)C)CC1 |
| InChI | InChI=1S/C22H31F2N3O2/c1-14(2)8-11-27-12-9-16(10-13-27)25-22(29)20(15(3)4)26-21(28)19-17(23)6-5-7-18(19)24/h5-8,15-16,20H,9-13H2,1-4H3,(H,25,29)(H,26,28) |
| InChIKey | VGDBHBXWTYPYIN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|