C20H27Cl2N3O2 — CID 86894333
2,4-dichloro-N-[3-methyl-1-oxo-1-[(1-prop-2-enylpiperidin-4-yl)amino]butan-2-yl]benzamide (PubChem CID 86894333) has the molecular formula C20H27Cl2N3O2 and a molecular weight of 412.36 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-methyl-1-oxo-1-[(1-prop-2-enylpiperidin-4-yl)amino]butan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-methyl-1-oxo-1-[(1-prop-2-enylpiperidin-4-yl)amino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 86894333 |
| Molecular Formula | C20H27Cl2N3O2 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2,4-dichloro-N-[3-methyl-1-oxo-1-[(1-prop-2-enylpiperidin-4-yl)amino]butan-2-yl]benzamide |
| SMILES | C=CCN1CCC(NC(=O)C(NC(=O)c2ccc(Cl)cc2Cl)C(C)C)CC1 |
| InChI | InChI=1S/C20H27Cl2N3O2/c1-4-9-25-10-7-15(8-11-25)23-20(27)18(13(2)3)24-19(26)16-6-5-14(21)12-17(16)22/h4-6,12-13,15,18H,1,7-11H2,2-3H3,(H,23,27)(H,24,26) |
| InChIKey | FGVZAKHYESQWFC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|