C23H28ClN3O2 — CID 56569861
N-(2-benzoyl-4-chlorophenyl)-2-[4-(propan-2-ylamino)piperidin-1-yl]acetamide (PubChem CID 56569861) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-2-[4-(propan-2-ylamino)piperidin-1-yl]acetamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-2-[4-(propan-2-ylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 56569861 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-2-[4-(propan-2-ylamino)piperidin-1-yl]acetamide |
| SMILES | CC(C)NC1CCN(CC(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H28ClN3O2/c1-16(2)25-19-10-12-27(13-11-19)15-22(28)26-21-9-8-18(24)14-20(21)23(29)17-6-4-3-5-7-17/h3-9,14,16,19,25H,10-13,15H2,1-2H3,(H,26,28) |
| InChIKey | GOLJKSUWSMVUAI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |