C23H25ClN2O4 — CID 56501325
N-(2-benzoyl-4-chlorophenyl)-2-[2-(1,3-dioxolan-2-yl)piperidin-1-yl]acetamide (PubChem CID 56501325) has the molecular formula C23H25ClN2O4 and a molecular weight of 428.92 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-2-[2-(1,3-dioxolan-2-yl)piperidin-1-yl]acetamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-2-[2-(1,3-dioxolan-2-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 56501325 |
| Molecular Formula | C23H25ClN2O4 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-2-[2-(1,3-dioxolan-2-yl)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCCCC1C1OCCO1)Nc1ccc(Cl)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H25ClN2O4/c24-17-9-10-19(18(14-17)22(28)16-6-2-1-3-7-16)25-21(27)15-26-11-5-4-8-20(26)23-29-12-13-30-23/h1-3,6-7,9-10,14,20,23H,4-5,8,11-13,15H2,(H,25,27) |
| InChIKey | UFORRSGBGCOPID-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |