C22H35N3O3 — CID 56570222
2-[(2-tert-butylcyclohexyl)amino]-N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methylacetamide (PubChem CID 56570222) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is 2-[(2-tert-butylcyclohexyl)amino]-N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methylacetamide.
| Compound Name | 2-[(2-tert-butylcyclohexyl)amino]-N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 56570222 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | 2-[(2-tert-butylcyclohexyl)amino]-N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methylacetamide |
| SMILES | COc1cccc(NC(=O)CN(C)C(=O)CNC2CCCCC2C(C)(C)C)c1 |
| InChI | InChI=1S/C22H35N3O3/c1-22(2,3)18-11-6-7-12-19(18)23-14-21(27)25(4)15-20(26)24-16-9-8-10-17(13-16)28-5/h8-10,13,18-19,23H,6-7,11-12,14-15H2,1-5H3,(H,24,26) |
| InChIKey | AJZHCESXYUPKRQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |