C16H23N3O2 — CID 60944498
N-(2-anilino-2-oxoethyl)-2-(cyclopentylamino)-N-methylacetamide (PubChem CID 60944498) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(2-anilino-2-oxoethyl)-2-(cyclopentylamino)-N-methylacetamide.
| Compound Name | N-(2-anilino-2-oxoethyl)-2-(cyclopentylamino)-N-methylacetamide |
|---|---|
| PubChem CID | 60944498 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-(2-anilino-2-oxoethyl)-2-(cyclopentylamino)-N-methylacetamide |
| SMILES | CN(CC(=O)Nc1ccccc1)C(=O)CNC1CCCC1 |
| InChI | InChI=1S/C16H23N3O2/c1-19(16(21)11-17-13-7-5-6-8-13)12-15(20)18-14-9-3-2-4-10-14/h2-4,9-10,13,17H,5-8,11-12H2,1H3,(H,18,20) |
| InChIKey | SJYSUFSOYZZODV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |