C20H17F2N5O4 — CID 56570822
5-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]-2,4-difluorobenzamide (PubChem CID 56570822) has the molecular formula C20H17F2N5O4 and a molecular weight of 429.38 g/mol. Its IUPAC name is 5-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]-2,4-difluorobenzamide.
| Compound Name | 5-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 56570822 |
| Molecular Formula | C20H17F2N5O4 |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 5-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]-2,4-difluorobenzamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)Nc3cc(C(N)=O)c(F)cc3F)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17F2N5O4/c1-10-18(27(30)31)11(2)26(25-10)9-12-3-5-13(6-4-12)20(29)24-17-7-14(19(23)28)15(21)8-16(17)22/h3-8H,9H2,1-2H3,(H2,23,28)(H,24,29) |
| InChIKey | ZYOXKIPSXVRCTK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|