C24H23N3O2S2 — CID 56571196
2-[4-methoxy-N-(thiophen-2-ylmethyl)anilino]-N-[phenyl(1,3-thiazol-2-yl)methyl]acetamide (PubChem CID 56571196) has the molecular formula C24H23N3O2S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is 2-[4-methoxy-N-(thiophen-2-ylmethyl)anilino]-N-[phenyl(1,3-thiazol-2-yl)methyl]acetamide.
| Compound Name | 2-[4-methoxy-N-(thiophen-2-ylmethyl)anilino]-N-[phenyl(1,3-thiazol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 56571196 |
| Molecular Formula | C24H23N3O2S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 2-[4-methoxy-N-(thiophen-2-ylmethyl)anilino]-N-[phenyl(1,3-thiazol-2-yl)methyl]acetamide |
| SMILES | COc1ccc(N(CC(=O)NC(c2ccccc2)c2nccs2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C24H23N3O2S2/c1-29-20-11-9-19(10-12-20)27(16-21-8-5-14-30-21)17-22(28)26-23(24-25-13-15-31-24)18-6-3-2-4-7-18/h2-15,23H,16-17H2,1H3,(H,26,28) |
| InChIKey | GNFWKUIGJZGSEG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|