C24H23N3O3 — CID 56572555
N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-6-(3-methylphenyl)-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 56572555) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-6-(3-methylphenyl)-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-6-(3-methylphenyl)-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56572555 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-6-(3-methylphenyl)-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCOc1ccc(N(CCC#N)C(=O)c2ccc(-c3cccc(C)c3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C24H23N3O3/c1-3-30-20-10-8-19(9-11-20)27(15-5-14-25)24(29)21-12-13-22(26-23(21)28)18-7-4-6-17(2)16-18/h4,6-13,16H,3,5,15H2,1-2H3,(H,26,28) |
| InChIKey | CIFFHIGCDMCLDU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |