C21H20N2O2S — CID 56534565
N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-3-methyl-1-benzothiophene-2-carboxamide (PubChem CID 56534565) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-3-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-3-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 56534565 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-3-methyl-1-benzothiophene-2-carboxamide |
| SMILES | CCOc1ccc(N(CCC#N)C(=O)c2sc3ccccc3c2C)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-3-25-17-11-9-16(10-12-17)23(14-6-13-22)21(24)20-15(2)18-7-4-5-8-19(18)26-20/h4-5,7-12H,3,6,14H2,1-2H3 |
| InChIKey | UAMZZQGMEYQOHH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |