C19H19NO2S — CID 18113160
N,3-dimethyl-N-(2-phenoxyethyl)-1-benzothiophene-2-carboxamide (PubChem CID 18113160) has the molecular formula C19H19NO2S and a molecular weight of 325.43 g/mol. Its IUPAC name is N,3-dimethyl-N-(2-phenoxyethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N,3-dimethyl-N-(2-phenoxyethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 18113160 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N,3-dimethyl-N-(2-phenoxyethyl)-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)N(C)CCOc2ccccc2)sc2ccccc12 |
| InChI | InChI=1S/C19H19NO2S/c1-14-16-10-6-7-11-17(16)23-18(14)19(21)20(2)12-13-22-15-8-4-3-5-9-15/h3-11H,12-13H2,1-2H3 |
| InChIKey | CYBLMJAMBHGIDL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |