C18H16O4S — CID 69121464
3-(3-phenoxypropoxy)-1-benzothiophene-2-carboxylic acid (PubChem CID 69121464) has the molecular formula C18H16O4S and a molecular weight of 328.39 g/mol. Its IUPAC name is 3-(3-phenoxypropoxy)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-(3-phenoxypropoxy)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 69121464 |
| Molecular Formula | C18H16O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 3-(3-phenoxypropoxy)-1-benzothiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc2ccccc2c1OCCCOc1ccccc1 |
| InChI | InChI=1S/C18H16O4S/c19-18(20)17-16(14-9-4-5-10-15(14)23-17)22-12-6-11-21-13-7-2-1-3-8-13/h1-5,7-10H,6,11-12H2,(H,19,20) |
| InChIKey | NSNRKGHBEARPQB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|