C14H16O4S2 — CID 63858102
3-(3-methoxypropylsulfinylmethyl)-1-benzothiophene-2-carboxylic acid (PubChem CID 63858102) has the molecular formula C14H16O4S2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 3-(3-methoxypropylsulfinylmethyl)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-(3-methoxypropylsulfinylmethyl)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63858102 |
| Molecular Formula | C14H16O4S2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 3-(3-methoxypropylsulfinylmethyl)-1-benzothiophene-2-carboxylic acid |
| SMILES | COCCCS(=O)Cc1c(C(=O)O)sc2ccccc12 |
| InChI | InChI=1S/C14H16O4S2/c1-18-7-4-8-20(17)9-11-10-5-2-3-6-12(10)19-13(11)14(15)16/h2-3,5-6H,4,7-9H2,1H3,(H,15,16) |
| InChIKey | GRQPLAFKWKQQEU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|