C13H13FO4S2 — CID 61304368
4-fluoro-3-(2-methoxyethylsulfinylmethyl)-1-benzothiophene-2-carboxylic acid (PubChem CID 61304368) has the molecular formula C13H13FO4S2 and a molecular weight of 316.38 g/mol. Its IUPAC name is 4-fluoro-3-(2-methoxyethylsulfinylmethyl)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 4-fluoro-3-(2-methoxyethylsulfinylmethyl)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61304368 |
| Molecular Formula | C13H13FO4S2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 4-fluoro-3-(2-methoxyethylsulfinylmethyl)-1-benzothiophene-2-carboxylic acid |
| SMILES | COCCS(=O)Cc1c(C(=O)O)sc2cccc(F)c12 |
| InChI | InChI=1S/C13H13FO4S2/c1-18-5-6-20(17)7-8-11-9(14)3-2-4-10(11)19-12(8)13(15)16/h2-4H,5-7H2,1H3,(H,15,16) |
| InChIKey | IYMXWFUNIGHSLQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |