C15H17FO2S2 — CID 107746401
4-fluoro-3-(3-methylbutylsulfanylmethyl)-1-benzothiophene-2-carboxylic acid (PubChem CID 107746401) has the molecular formula C15H17FO2S2 and a molecular weight of 312.43 g/mol. Its IUPAC name is 4-fluoro-3-(3-methylbutylsulfanylmethyl)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 4-fluoro-3-(3-methylbutylsulfanylmethyl)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 107746401 |
| Molecular Formula | C15H17FO2S2 |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 4-fluoro-3-(3-methylbutylsulfanylmethyl)-1-benzothiophene-2-carboxylic acid |
| SMILES | CC(C)CCSCc1c(C(=O)O)sc2cccc(F)c12 |
| InChI | InChI=1S/C15H17FO2S2/c1-9(2)6-7-19-8-10-13-11(16)4-3-5-12(13)20-14(10)15(17)18/h3-5,9H,6-8H2,1-2H3,(H,17,18) |
| InChIKey | RKFRDYWIMDFBAS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|