C13H13FN2O3S — CID 43374115
3-[[(2-amino-2-oxoethyl)-methylamino]methyl]-4-fluoro-1-benzothiophene-2-carboxylic acid (PubChem CID 43374115) has the molecular formula C13H13FN2O3S and a molecular weight of 296.32 g/mol. Its IUPAC name is 3-[[(2-amino-2-oxoethyl)-methylamino]methyl]-4-fluoro-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-[[(2-amino-2-oxoethyl)-methylamino]methyl]-4-fluoro-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43374115 |
| Molecular Formula | C13H13FN2O3S |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3-[[(2-amino-2-oxoethyl)-methylamino]methyl]-4-fluoro-1-benzothiophene-2-carboxylic acid |
| SMILES | CN(CC(N)=O)Cc1c(C(=O)O)sc2cccc(F)c12 |
| InChI | InChI=1S/C13H13FN2O3S/c1-16(6-10(15)17)5-7-11-8(14)3-2-4-9(11)20-12(7)13(18)19/h2-4H,5-6H2,1H3,(H2,15,17)(H,18,19) |
| InChIKey | IARMLIPTMSPCNF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |