C16H20FNO3S — CID 111488335
methyl 4-fluoro-3-[[3-hydroxybutyl(methyl)amino]methyl]-1-benzothiophene-2-carboxylate (PubChem CID 111488335) has the molecular formula C16H20FNO3S and a molecular weight of 325.41 g/mol. Its IUPAC name is methyl 4-fluoro-3-[[3-hydroxybutyl(methyl)amino]methyl]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 4-fluoro-3-[[3-hydroxybutyl(methyl)amino]methyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 111488335 |
| Molecular Formula | C16H20FNO3S |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | methyl 4-fluoro-3-[[3-hydroxybutyl(methyl)amino]methyl]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cccc(F)c2c1CN(C)CCC(C)O |
| InChI | InChI=1S/C16H20FNO3S/c1-10(19)7-8-18(2)9-11-14-12(17)5-4-6-13(14)22-15(11)16(20)21-3/h4-6,10,19H,7-9H2,1-3H3 |
| InChIKey | UXCCEAPMPLKKGL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |