C13H14FN3O3S — CID 103262438
3-[[2-(carbamoylamino)ethylamino]methyl]-4-fluoro-1-benzothiophene-2-carboxylic acid (PubChem CID 103262438) has the molecular formula C13H14FN3O3S and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-[[2-(carbamoylamino)ethylamino]methyl]-4-fluoro-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-[[2-(carbamoylamino)ethylamino]methyl]-4-fluoro-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103262438 |
| Molecular Formula | C13H14FN3O3S |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 3-[[2-(carbamoylamino)ethylamino]methyl]-4-fluoro-1-benzothiophene-2-carboxylic acid |
| SMILES | NC(=O)NCCNCc1c(C(=O)O)sc2cccc(F)c12 |
| InChI | InChI=1S/C13H14FN3O3S/c14-8-2-1-3-9-10(8)7(11(21-9)12(18)19)6-16-4-5-17-13(15)20/h1-3,16H,4-6H2,(H,18,19)(H3,15,17,20) |
| InChIKey | CLIKVSACURBLDF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|