C15H16FNO2S — CID 103255089
3-[(2-cyclopropylethylamino)methyl]-4-fluoro-1-benzothiophene-2-carboxylic acid (PubChem CID 103255089) has the molecular formula C15H16FNO2S and a molecular weight of 293.36 g/mol. Its IUPAC name is 3-[(2-cyclopropylethylamino)methyl]-4-fluoro-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-[(2-cyclopropylethylamino)methyl]-4-fluoro-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103255089 |
| Molecular Formula | C15H16FNO2S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 3-[(2-cyclopropylethylamino)methyl]-4-fluoro-1-benzothiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc2cccc(F)c2c1CNCCC1CC1 |
| InChI | InChI=1S/C15H16FNO2S/c16-11-2-1-3-12-13(11)10(14(20-12)15(18)19)8-17-7-6-9-4-5-9/h1-3,9,17H,4-8H2,(H,18,19) |
| InChIKey | KWCFJDDELITHOI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|