C15H18FNO2S — CID 103230427
4-fluoro-3-[(3-methylbutan-2-ylamino)methyl]-1-benzothiophene-2-carboxylic acid (PubChem CID 103230427) has the molecular formula C15H18FNO2S and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-fluoro-3-[(3-methylbutan-2-ylamino)methyl]-1-benzothiophene-2-carboxylic acid.
| Compound Name | 4-fluoro-3-[(3-methylbutan-2-ylamino)methyl]-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103230427 |
| Molecular Formula | C15H18FNO2S |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 4-fluoro-3-[(3-methylbutan-2-ylamino)methyl]-1-benzothiophene-2-carboxylic acid |
| SMILES | CC(C)C(C)NCc1c(C(=O)O)sc2cccc(F)c12 |
| InChI | InChI=1S/C15H18FNO2S/c1-8(2)9(3)17-7-10-13-11(16)5-4-6-12(13)20-14(10)15(18)19/h4-6,8-9,17H,7H2,1-3H3,(H,18,19) |
| InChIKey | NLTWDLNKIKIWGL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |