C14H18FN3OS2 — CID 66228882
3-(2-aminobutylsulfanylmethyl)-4-fluoro-1-benzothiophene-2-carbohydrazide (PubChem CID 66228882) has the molecular formula C14H18FN3OS2 and a molecular weight of 327.45 g/mol. Its IUPAC name is 3-(2-aminobutylsulfanylmethyl)-4-fluoro-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-(2-aminobutylsulfanylmethyl)-4-fluoro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 66228882 |
| Molecular Formula | C14H18FN3OS2 |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 3-(2-aminobutylsulfanylmethyl)-4-fluoro-1-benzothiophene-2-carbohydrazide |
| SMILES | CCC(N)CSCc1c(C(=O)NN)sc2cccc(F)c12 |
| InChI | InChI=1S/C14H18FN3OS2/c1-2-8(16)6-20-7-9-12-10(15)4-3-5-11(12)21-13(9)14(19)18-17/h3-5,8H,2,6-7,16-17H2,1H3,(H,18,19) |
| InChIKey | AXUBZZQRKQXYEG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|