C13H13FN2O2S — CID 55214172
4-fluoro-3-(prop-2-enoxymethyl)-1-benzothiophene-2-carbohydrazide (PubChem CID 55214172) has the molecular formula C13H13FN2O2S and a molecular weight of 280.32 g/mol. Its IUPAC name is 4-fluoro-3-(prop-2-enoxymethyl)-1-benzothiophene-2-carbohydrazide.
| Compound Name | 4-fluoro-3-(prop-2-enoxymethyl)-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 55214172 |
| Molecular Formula | C13H13FN2O2S |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-fluoro-3-(prop-2-enoxymethyl)-1-benzothiophene-2-carbohydrazide |
| SMILES | C=CCOCc1c(C(=O)NN)sc2cccc(F)c12 |
| InChI | InChI=1S/C13H13FN2O2S/c1-2-6-18-7-8-11-9(14)4-3-5-10(11)19-12(8)13(17)16-15/h2-5H,1,6-7,15H2,(H,16,17) |
| InChIKey | LMDLZGHOASBVSM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|