C16H20FNO4S — CID 122152026
4-fluoro-N-(1-hydroxy-3-methylbutan-2-yl)oxy-3-(methoxymethyl)-1-benzothiophene-2-carboxamide (PubChem CID 122152026) has the molecular formula C16H20FNO4S and a molecular weight of 341.40 g/mol. Its IUPAC name is 4-fluoro-N-(1-hydroxy-3-methylbutan-2-yl)oxy-3-(methoxymethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-N-(1-hydroxy-3-methylbutan-2-yl)oxy-3-(methoxymethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 122152026 |
| Molecular Formula | C16H20FNO4S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 4-fluoro-N-(1-hydroxy-3-methylbutan-2-yl)oxy-3-(methoxymethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COCc1c(C(=O)NOC(CO)C(C)C)sc2cccc(F)c12 |
| InChI | InChI=1S/C16H20FNO4S/c1-9(2)12(7-19)22-18-16(20)15-10(8-21-3)14-11(17)5-4-6-13(14)23-15/h4-6,9,12,19H,7-8H2,1-3H3,(H,18,20) |
| InChIKey | PARBZOXAINEXKQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|