C19H17ClFNO2S — CID 24543954
N-[1-(2-chlorophenyl)ethyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide (PubChem CID 24543954) has the molecular formula C19H17ClFNO2S and a molecular weight of 377.87 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)ethyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-[1-(2-chlorophenyl)ethyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 24543954 |
| Molecular Formula | C19H17ClFNO2S |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | N-[1-(2-chlorophenyl)ethyl]-4-fluoro-3-(methoxymethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COCc1c(C(=O)NC(C)c2ccccc2Cl)sc2cccc(F)c12 |
| InChI | InChI=1S/C19H17ClFNO2S/c1-11(12-6-3-4-7-14(12)20)22-19(23)18-13(10-24-2)17-15(21)8-5-9-16(17)25-18/h3-9,11H,10H2,1-2H3,(H,22,23) |
| InChIKey | VJJMYSZQMNWZQJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |