C20H17F2NO4S — CID 69121841
5-[[2-[(2,6-difluorophenyl)carbamoyl]-1-benzothiophen-3-yl]oxy]pentanoic acid (PubChem CID 69121841) has the molecular formula C20H17F2NO4S and a molecular weight of 405.42 g/mol. Its IUPAC name is 5-[[2-[(2,6-difluorophenyl)carbamoyl]-1-benzothiophen-3-yl]oxy]pentanoic acid.
| Compound Name | 5-[[2-[(2,6-difluorophenyl)carbamoyl]-1-benzothiophen-3-yl]oxy]pentanoic acid |
|---|---|
| PubChem CID | 69121841 |
| Molecular Formula | C20H17F2NO4S |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 5-[[2-[(2,6-difluorophenyl)carbamoyl]-1-benzothiophen-3-yl]oxy]pentanoic acid |
| SMILES | O=C(O)CCCCOc1c(C(=O)Nc2c(F)cccc2F)sc2ccccc12 |
| InChI | InChI=1S/C20H17F2NO4S/c21-13-7-5-8-14(22)17(13)23-20(26)19-18(27-11-4-3-10-16(24)25)12-6-1-2-9-15(12)28-19/h1-2,5-9H,3-4,10-11H2,(H,23,26)(H,24,25) |
| InChIKey | BXRXIKMTWAEVEB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|