C22H29NO4S — CID 69121438
6-[[2-(cyclohexylmethylcarbamoyl)-1-benzothiophen-3-yl]oxy]hexanoic acid (PubChem CID 69121438) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is 6-[[2-(cyclohexylmethylcarbamoyl)-1-benzothiophen-3-yl]oxy]hexanoic acid.
| Compound Name | 6-[[2-(cyclohexylmethylcarbamoyl)-1-benzothiophen-3-yl]oxy]hexanoic acid |
|---|---|
| PubChem CID | 69121438 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 6-[[2-(cyclohexylmethylcarbamoyl)-1-benzothiophen-3-yl]oxy]hexanoic acid |
| SMILES | O=C(O)CCCCCOc1c(C(=O)NCC2CCCCC2)sc2ccccc12 |
| InChI | InChI=1S/C22H29NO4S/c24-19(25)13-5-2-8-14-27-20-17-11-6-7-12-18(17)28-21(20)22(26)23-15-16-9-3-1-4-10-16/h6-7,11-12,16H,1-5,8-10,13-15H2,(H,23,26)(H,24,25) |
| InChIKey | XEHWHGSPIRGHSG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|